Difference between revisions of "Template:Drug/83915-83-7"

From blackwiki
Jump to navigation Jump to search
imported>Plastikspork
Line 1: Line 1:
{{drugbox
+
#REDIRECT [[Template:Drugbox]]
| verifiedrevid = 408577806
 
| IUPAC_name = ''N''<sup>2</sup>-[(1''S'')-1-carboxy-3-phenylpropyl]-<small>L</small>-lysyl-<small>L</small>-proline
 
|synonyms = <small>(2''S'')-1-[(2''S'')-6-amino-2-{[(1''S'')-1-carboxy-3-phenylpropyl]amino}hexanoyl]pyrrolidine-2-carboxylic acid</small>
 
| image = Lisinopril.svg
 
| InChI = 1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1
 
| InChIKey = RLAWWYSOJDYHDC-BZSNNMDCBR
 
| ChEMBL_Ref = {{ebicite|correct|EBI}}
 
| ChEMBL = 1237
 
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 
| StdInChI = 1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1
 
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 
| StdInChIKey = RLAWWYSOJDYHDC-BZSNNMDCSA-N
 
| CAS_number = 83915-83-7
 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 
| ChemSpiderID = 4514933
 
| ATC_prefix = C09
 
| ATC_suffix = AA03
 
| ATC_supplemental =
 
| PubChem = 5362119
 
| DrugBank = APRD00560
 
| KEGG_Ref = {{keggcite|correct|kegg}}
 
| KEGG = D00362
 
| C=21 | H=31 | N=3 | O=5
 
| molecular_weight = 405.488 g/mol
 
| smiles = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)O)CCc1ccccc1)CCCCN)CCC2
 
| bioavailability = approx. 25%, but wide range between individuals (6 to 60%)
 
| protein_bound = 0
 
| metabolism = None
 
| elimination_half-life = 12 hours
 
| excretion = Eliminated unchanged in Urine
 
| pregnancy_category = D - [[teratogenic]]
 
| legal_status = Rx-only
 
| routes_of_administration = PO
 
}}<noinclude>
 
 
 
{{documentation|content=
 
 
 
}}
 
 
 
[[Category:Medicine infobox templates]]
 
 
 
</noinclude>
 

Revision as of 00:15, 21 July 2012

Redirect to: