Difference between revisions of "Template:Drug/83915-83-7"

From blackwiki
Jump to navigation Jump to search
imported>Boghog
(created template)
 
Line 33: Line 33:
 
| legal_status = Rx-only
 
| legal_status = Rx-only
 
| routes_of_administration = PO
 
| routes_of_administration = PO
 +
}}<noinclude>
 +
 +
{{documentation|content=
 +
 
}}
 
}}
 +
 +
[[Category:Medicine infobox templates]]
 +
 +
</noinclude>

Revision as of 03:09, 14 July 2012

{{drugbox | verifiedrevid = 408577806 | IUPAC_name = N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-proline |synonyms = (2S)-1-[(2S)-6-amino-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}hexanoyl]pyrrolidine-2-carboxylic acid | image = Lisinopril.svg | InChI = 1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 | InChIKey = RLAWWYSOJDYHDC-BZSNNMDCBR | ChEMBL_Ref =  7pxY | ChEMBL = 1237 | StdInChI_Ref = Template:Stdinchicite | StdInChI = 1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 | StdInChIKey_Ref = Template:Stdinchicite | StdInChIKey = RLAWWYSOJDYHDC-BZSNNMDCSA-N | CAS_number = 83915-83-7 | ChemSpiderID_Ref =  7pxY | ChemSpiderID = 4514933 | ATC_prefix = C09 | ATC_suffix = AA03 | ATC_supplemental = | PubChem = 5362119 | DrugBank = APRD00560 | KEGG_Ref =  7pxY | KEGG = D00362 | C=21 | H=31 | N=3 | O=5 | molecular_weight = 405.488 g/mol | smiles = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)O)CCc1ccccc1)CCCCN)CCC2 | bioavailability = approx. 25%, but wide range between individuals (6 to 60%) | protein_bound = 0 | metabolism = None | elimination_half-life = 12 hours | excretion = Eliminated unchanged in Urine | pregnancy_category = D - teratogenic | legal_status = Rx-only | routes_of_administration = PO }}

50px Template documentation[create]