Difference between revisions of "Template:Drug/83915-83-7"
imported>Boghog (created template) |
|||
| Line 33: | Line 33: | ||
| legal_status = Rx-only | | legal_status = Rx-only | ||
| routes_of_administration = PO | | routes_of_administration = PO | ||
| + | }}<noinclude> | ||
| + | |||
| + | {{documentation|content= | ||
| + | |||
}} | }} | ||
| + | |||
| + | [[Category:Medicine infobox templates]] | ||
| + | |||
| + | </noinclude> | ||
Revision as of 03:09, 14 July 2012
{{drugbox
| verifiedrevid = 408577806
| IUPAC_name = N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-proline
|synonyms = (2S)-1-[(2S)-6-amino-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}hexanoyl]pyrrolidine-2-carboxylic acid
| image = Lisinopril.svg
| InChI = 1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1
| InChIKey = RLAWWYSOJDYHDC-BZSNNMDCBR
| ChEMBL_Ref =
| ChEMBL = 1237
| StdInChI_Ref = Template:Stdinchicite
| StdInChI = 1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1
| StdInChIKey_Ref = Template:Stdinchicite
| StdInChIKey = RLAWWYSOJDYHDC-BZSNNMDCSA-N
| CAS_number = 83915-83-7
| ChemSpiderID_Ref =
| ChemSpiderID = 4514933
| ATC_prefix = C09
| ATC_suffix = AA03
| ATC_supplemental =
| PubChem = 5362119
| DrugBank = APRD00560
| KEGG_Ref =
| KEGG = D00362
| C=21 | H=31 | N=3 | O=5
| molecular_weight = 405.488 g/mol
| smiles = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)O)CCc1ccccc1)CCCCN)CCC2
| bioavailability = approx. 25%, but wide range between individuals (6 to 60%)
| protein_bound = 0
| metabolism = None
| elimination_half-life = 12 hours
| excretion = Eliminated unchanged in Urine
| pregnancy_category = D - teratogenic
| legal_status = Rx-only
| routes_of_administration = PO
}}
| Editors can experiment in this template's sandbox (create | mirror) and testcases (create) pages. Please add categories to the /doc subpage. Subpages of this template. |