Difference between revisions of "Template:Infobox drug/testcases5"
Jump to navigation
Jump to search
imported>DePiep (→Test 2) |
imported>DePiep (→Test 1) |
||
| Line 42: | Line 42: | ||
|PubChem=4091 | |PubChem=4091 | ||
|PubChemSubstance=10099 | |PubChemSubstance=10099 | ||
| + | }} | ||
| + | |||
| + | == index-2 == | ||
| + | {{testcase table | ||
| + | | drug_name = ID's | ||
| + | | Verifiedfields = changed | ||
| + | | verifiedrevid = 415028406 | ||
| + | |||
| + | <!--Identifiers--> | ||
| + | | CAS_number_Ref = {{cascite|correct|??}} | ||
| + | | CAS_number = 165800-03-3 | ||
| + | | CAS_number2 = 165800-03-2 | ||
| + | | DrugBank = DB00601 | ||
| + | | DrugBank2 = DB00602 | ||
| + | | DrugBank_Ref = {{drugbankcite|monkey|??}} | ||
| + | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| + | | ChemSpiderID = 390139 | ||
| + | | ChemSpiderID2 = 390132 | ||
| + | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| + | | UNII = ISQ9I6J12J | ||
| + | | UNII2 = ISQ9I6J122 | ||
| + | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| + | | KEGG = D00947 | ||
| + | | KEGG2 = D00942 | ||
| + | | ChEMBL_Ref = {{ebicite|correct|EBI1}} | ||
| + | | ChEMBL = 126 | ||
| + | | ChEMBL2 = 1262 | ||
| + | | ChEBI_Ref = {{ebicite|correct|EBI2}} | ||
| + | | ChEBI = 127 | ||
| + | | ChEBI2 = 1272 | ||
| + | |||
| + | | SMILES = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3 | ||
| + | | SMILES2 = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2 | ||
| + | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| + | | StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 | ||
| + | | StdInChI2 = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2 | ||
| + | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| + | | StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N | ||
| + | | StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-2 | ||
| + | |||
| + | <!--NOT verif--> | ||
| + | | ATC_prefix = J01 | ||
| + | | ATC_suffix = XX08 | ||
| + | | NIAID_ChemDB = 070944 | ||
| + | | NIAID_ChemDB2 = 070942 | ||
| + | | PDB_ligand = ZLD | ||
| + | | PDB_ligand2 = ZLD2 | ||
| + | |PubChem=4091 | ||
| + | |PubChem2=4092 | ||
| + | |PubChemSubstance=10099 | ||
}} | }} | ||
Revision as of 21:28, 6 July 2015
drugbox_verifiedfields=ChemSpiderID|DrugBank|UNII |ChEMBL|ChEBI|KEGG|StdInChI|StdInChIKey|CAS_number drugbox_watchedfields=IUPAC_name|molecular_weight |ATC_prefix|ATC_suffix|ATC_supplemental|smiles|C|H|N|O|Cl|PubChem|melting_point|PIN
- From a page move: This is a redirect from a page that has been moved (renamed). This page was kept as a redirect to avoid breaking links, both internal and external, that may have been made to the old page name.
Contents
Test 1
index-2
Test 2
- SID and CID (SID suppressed)
data page
|data_page=or exists, demo page = ???