Template:Infobox mineral
| {{PAGENAME}} | |
|---|---|
| General |
[[Category:Infobox templates|Template:Remove first word]]
| This template uses Lua: |
This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.
Usage
Most field names are in lowercase.
Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.
| Ruby | |
|---|---|
A naturally occurring ruby crystal | |
| General | |
| Category | Mineral variety |
| Formula (repeating unit) | aluminium oxide with chromium, Al2O3:Cr |
| Crystal system | Trigonal |
| Crystal class | Hexagonal scalenohedral (Template:Overlinem) H-M symbol: (Template:Overline 2/m) |
| Space group | RTemplate:Overlinec (No. 167) |
| Unit cell | unit cell |
| Identification | |
| Color | Red, may be brownish, purplish or pinkish |
| Crystal habit | Varies with locality. Terminated tabular hexagonal prisms. |
| Cleavage | No true cleavage |
| Fracture | Uneven or conchoidal |
| Mohs scale hardness | 9.0 |
| Luster | Vitreous |
| Streak | white |
| Diaphaneity | transparent |
| Specific gravity | 4.0 |
| Refractive index | nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008 |
| Pleochroism | Orangey red, purplish red |
| Ultraviolet fluorescence | red under longwave |
| Melting point | 2044 °C |
| Solubility | none |
| Major varieties | |
| Sapphire | Any color except red and violet |
| Oriental amethyst | violet color |
| Corundum | various colors (mineral species) |
| Emery | Granular (mineral mixture) |
{{Infobox mineral
| name =
| boxwidth =
| boxbgcolor =
| image =
| imagesize =
| alt =
| caption =
| struct image =
| struct caption =
| struct imagesize =
| struct2 image =
| struct2 caption =
| struct2 imagesize=
| SMILES =
| Jmol =
| category =
| formula =
| molweight =
| strunz =
| dana =
| system =
| class =
| symmetry =
| unit cell =
| color =
| colour =
| habit =
| twinning =
| cleavage =
| fracture =
| tenacity =
| toughness =
| mohs =
| luster =
| streak =
| diaphaneity =
| gravity =
| density =
| polish =
| opticalprop =
| refractive =
| birefringence =
| pleochroism =
| 2V =
| dispersion =
| extinction =
| length fast/slow =
| fluorescence =
| absorption =
| melt =
| Curie temp =
| fusibility =
| diagnostic =
| solubility =
| impurities =
| alteration =
| other =
| prop1 =
| prop1text =
| references =
| var1 =
| var1text =
| var2 =
| var2text =
| var3 =
| var3text =
| var4 =
| var4text =
| var5 =
| var5text =
| var6 =
| var6text =
}}
All parameters used
| name | |
|---|---|
caption | |
| General | |
| Category | category |
| Formula (repeating unit) | formula |
| Strunz classification | strunz |
| Dana classification | dana |
| Crystal system | system |
| Crystal class | class |
| Space group | symmetry |
| Unit cell | unit cell |
| Structure | |
Crystal structure of α-tridymite | |
| File:Diamond lattice.stl
Some other image | |
| Jmol (3D) | Interactive image |
| Identification | |
| Formula mass | molweight |
| Colour | colorcolour |
| Crystal habit | habit |
| Twinning | twinning |
| Cleavage | cleavage |
| Fracture | fracture |
| Tenacity | tenacity |
| Mohs scale hardness | mohs |
| Lustre | luster |
| Streak | streak |
| Diaphaneity | diaphaneity |
| Specific gravity | gravity |
| Density | density |
| Polish lustre | polish |
| Optical properties | opticalprop |
| Refractive index | refractive |
| Birefringence | birefringence |
| Pleochroism | pleochroism |
| 2V angle | 2V |
| Dispersion | dispersion |
| Extinction | extinction |
| Length fast/slow | length fast/slow |
| Ultraviolet fluorescence | fluorescence |
| Absorption spectra | absorption |
| Melting point | melt |
| Fusibility | fusibility |
| Diagnostic features | diagnostic |
| Solubility | solubility |
| Common impurities | impurities |
| Alters to | alteration |
| Other characteristics | other |
| prop1 | prop1text |
| References | references |
| Major varieties | |
| var1 | var1text |
| var2 | var2text |
| var3 | var3text |
| var4 | var4text |
| var5 | var5text |
| var6 | var6text |
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg | imagesize = 260px |struct image=a-tridymite.png |struct caption=Crystal structure of α-tridymite |struct imagesize=150px |struct2 image=Diamond lattice.stl |struct2 caption=Some other image |struct2 imagesize=200px |SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4 |Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test --> |boxbgcolor = yellow | 2V = 2V | absorption = absorption | alt = alt | alteration = alteration | birefringence = birefringence | boxtextcolor = boxtextcolor | boxwidth = boxwidth | caption = caption | category = category | class = class | cleavage = cleavage | color = color | colour = colour | dana = dana | density = density | diagnostic = diagnostic | diaphaneity = diaphaneity | dispersion = dispersion | extinction = extinction | fluorescence = fluorescence | formula = formula | fracture = fracture | fusibility = fusibility | gravity = gravity | habit = habit | impurities = impurities | length fast/slow = length fast/slow | luster = luster | lustre = lustre | melt = melt | mohs = mohs | molweight = molweight | name = name | opticalprop = opticalprop | other = other | pleochroism = pleochroism | polish = polish | polish lustre = polish lustre | prop1 = prop1 | prop1text = prop1text | references = references | refractive = refractive | solubility = solubility | streak = streak | strunz = strunz | symmetry = symmetry | system = system | tenacity = tenacity | twinning = twinning | unit cell = unit cell | var1 = var1 | var1text = var1text | var2 = var2 | var2text = var2text | var3 = var3 | var3text = var3text | var4 = var4 | var4text = var4text | var5 = var5 | var5text = var5text | var6 = var6 | var6text = var6text
Description
This should describe the parameters used in this template.
| Parameter | Explanation | Example |
|---|---|---|
| name | IMA mineral name (if there is another common name, put it in parentheses) | Baryte (Barite) |
| boxwidth | ||
| boxbgcolor | Background color of box headers | |
| boxtextcolor | Text color of box headers | |
| image | Wikimedia Commons image filename (to go at top) | Epidoto.jpeg |
| imagesize | ||
| alt | alt text for image, for visually impaired readers; see WP:ALT | Agglomeration of dark cylindrical crystals |
| caption | image caption | Epidote crystals |
| category | broad group then subgroup then sub-subgroup (if applicable) template does not auto-link | Sulfate minerals, Barite group |
| formula | chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network | BaSO4 |
| strunz | Nickel-Strunz classification of the mineral (10 ed, MinDat) | 9.BG.05 |
| dana | Dana classification of the mineral | 28.03.01.01 |
| symmetry | Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group | |
| unit cell | Unit cell dimensions and number (Z) of formula units per unit cell | |
| molweight | molar mass of the chemical formula above | |
| color | common colors of the mineral | |
| colour | same as above, but for British pages | |
| habit | common mineral habit | |
| system | crystal system (cubic, etc.) | |
| class | crystal class | |
| twinning | common type of twinning | |
| cleavage | type of cleavage | |
| fracture | type of fracture (appearance of broken surface) | irregular |
| tenacity | tenacity (how the mineral can deform or break) | brittle |
| toughness | toughness (quantitative resistance to deformation or breakage) | |
| mohs | hardness (scratchability) of mineral on Mohs hardness scale | 3-3.5 |
| luster | way the mineral reflects light, see luster | |
| lustre | same as above, but for British pages | |
| streak | see streak | |
| diaphaneity | transparency of mineral | |
| gravity | specific gravity | |
| density | density at STP in g/cm3 | |
| polish | ability to take a polish | |
| opticalprop | ||
| refractive | refractive index of mineral | |
| birefringence | birefringence of a 30micron thin section | |
| pleochroism | see pleochroism | |
| 2V | 2V angle | |
| dispersion | see dispersion | |
| extinction | extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals). | |
| length fast/slow | Sign of elongation: length fast or length slow | |
| fluorescence | see fluorescence | |
| absorption | see absorption | |
| melt | melting point of mineral | |
| Curie | Curie temperature of mineral | |
| fusibility | fusibility of mineral | |
| diagnostic | key way to recognize mineral | |
| solubility | solubility of mineral in water at STP | |
| impurities | common impurities | |
| alteration | alteration products | |
| other | ||
| prop1 | ||
| prop1text | ||
| references | use the Wikipedia template:ref to cite | References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed. |
| var1 | ||
| var1text | ||
| var2 | ||
| var2text | ||
| var3 | ||
| var3text | ||
| var4 | ||
| var4text | ||
| var5 | ||
| var5text | ||
| var6 | ||
| var6text |
TemplateData
TemplateData for Infobox mineral
No description.
| Parameter | Description | Type | Status | |
|---|---|---|---|---|
| Boxwidth | boxwidth | no description | Unknown | optional |
| Boxtextcolor | boxtextcolor | no description | Unknown | optional |
| Boxbgcolor | boxbgcolor | no description | Unknown | optional |
| Name | name | no description | Unknown | optional |
| Image | image | no description | Unknown | optional |
| Imagesize | imagesize | no description | Unknown | optional |
| Alt | alt | no description | Unknown | optional |
| Caption | caption | no description | Unknown | optional |
| Category | category | no description | Unknown | optional |
| Formula | formula | no description | Unknown | optional |
| Strunz | strunz | no description | Unknown | optional |
| System | system | no description | Unknown | optional |
| Dana | dana | no description | Unknown | optional |
| Class | class | no description | Unknown | optional |
| Symmetry | symmetry | no description | Unknown | optional |
| Unit cell | unit cell | no description | Unknown | optional |
| Molweight | molweight | no description | Unknown | optional |
| Color | color | no description | Unknown | optional |
| Habit | habit | no description | Unknown | optional |
| Twinning | twinning | no description | Unknown | optional |
| Cleavage | cleavage | no description | Unknown | optional |
| Fracture | fracture | no description | Unknown | optional |
| Tenacity | tenacity | no description | Unknown | optional |
| Mohs | mohs | no description | Unknown | optional |
| Luster | luster | no description | Unknown | optional |
| Polish | polish | no description | Unknown | optional |
| Opticalprop | opticalprop | no description | Unknown | optional |
| Refractive | refractive | no description | Unknown | optional |
| Birefringence | birefringence | no description | Unknown | optional |
| Pleochroism | pleochroism | no description | Unknown | optional |
| 2V | 2V | no description | Unknown | optional |
| Dispersion | dispersion | no description | Unknown | optional |
| Extinction | extinction | no description | Unknown | optional |
| Length fast/slow | length fast/slow | no description | Unknown | optional |
| Fluorescence | fluorescence | no description | Unknown | optional |
| Absorption | absorption | no description | Unknown | optional |
| Streak | streak | no description | Unknown | optional |
| Gravity | gravity | no description | Unknown | optional |
| Density | density | no description | Unknown | optional |
| Melt | melt | no description | Unknown | optional |
| Fusibility | fusibility | no description | Unknown | optional |
| Diagnostic | diagnostic | no description | Unknown | optional |
| Solubility | solubility | no description | Unknown | optional |
| Diaphaneity | diaphaneity | no description | Unknown | optional |
| Impurities | impurities | no description | Unknown | optional |
| Alteration | alteration | no description | Unknown | optional |
| Other | other | no description | Unknown | optional |
| Prop1text | prop1text | no description | Unknown | optional |
| References | references | no description | Unknown | optional |
| Colour | colour | no description | Unknown | optional |
| Lustre | lustre | no description | Unknown | optional |
| Polish lustre | polish lustre | no description | Unknown | optional |
| Prop1 | prop1 | no description | Unknown | optional |
| Var1 | var1 | no description | Unknown | optional |
| Var1text | var1text | no description | Unknown | optional |
| Var2 | var2 | no description | Unknown | optional |
| Var2text | var2text | no description | Unknown | optional |
| Var3 | var3 | no description | Unknown | optional |
| Var3text | var3text | no description | Unknown | optional |
| Var4 | var4 | no description | Unknown | optional |
| Var4text | var4text | no description | Unknown | optional |
| Var5 | var5 | no description | Unknown | optional |
| Var5text | var5text | no description | Unknown | optional |
| Var6 | var6 | no description | Unknown | optional |
| Var6text | var6text | no description | Unknown | optional |
| Struct image | struct image | no description | Unknown | optional |
| Struct2 image | struct2 image | no description | Unknown | optional |
| Struct caption | struct caption | no description | Unknown | optional |
| Struct imagesize | struct imagesize | no description | Unknown | optional |
| Struct alt | struct alt | no description | Unknown | optional |
| Struct2 imagesize | struct2 imagesize | no description | Unknown | optional |
| Struct2 caption | struct2 caption | no description | Unknown | optional |
| Struct2 alt | struct2 alt | no description | Unknown | optional |
| Jmol | Jmol | no description | Unknown | optional |
| SMILES | SMILES | no description | Unknown | optional |
Tracking category
| The above documentation is transcluded from Template:Infobox mineral/doc. (edit | history) Editors can experiment in this template's sandbox (edit | diff) and testcases (edit) pages. Please add categories to the /doc subpage. Subpages of this template. |